About 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate
1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate (PubChem CID 11076832) has the molecular formula C15H20O5
and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate |
| PubChem CID | 11076832 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OC(C)(C)C)[C@H]1C=CC(=O)C1 |
| InChI | InChI=1S/C15H20O5/c1-5-8-19-13(17)12(10-6-7-11(16)9-10)14(18)20-15(2,3)4/h5-7,10,12H,1,8-9H2,2-4H3/t10-,12?/m0/s1 |
| InChIKey | ZVSIPLSSDCVJDY-NUHJPDEHSA-N |
| XLogP | 1.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate?
The IUPAC name of 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate (CID 11076832) is 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate.
What is the SMILES notation for 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate?
The canonical SMILES for 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate is C=CCOC(=O)C(C(=O)OC(C)(C)C)[C@H]1C=CC(=O)C1.
What is the InChIKey of 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate?
The InChIKey is ZVSIPLSSDCVJDY-NUHJPDEHSA-N. The full InChI is InChI=1S/C15H20O5/c1-5-8-19-13(17)12(10-6-7-11(16)9-10)14(18)20-15(2,3)4/h5-7,10,12H,1,8-9H2,2-4H3/t10-,12?/m0/s1.
What are the key properties of 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate?
1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate has a molecular weight of 280.32 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 3-O-prop-2-enyl 2-[(1R)-4-oxocyclopent-2-en-1-yl]propanedioate is sourced from PubChem (CID 11076832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).