C10H9F3O4S — CID 11076887
(E)-4-(benzenesulfonyl)-1,1,1-trifluorobut-3-ene-2,2-diol (PubChem CID 11076887) has the molecular formula C10H9F3O4S and a molecular weight of 282.24 g/mol. Its IUPAC name is (E)-4-(benzenesulfonyl)-1,1,1-trifluorobut-3-ene-2,2-diol.
| Compound Name | (E)-4-(benzenesulfonyl)-1,1,1-trifluorobut-3-ene-2,2-diol |
|---|---|
| PubChem CID | 11076887 |
| Molecular Formula | C10H9F3O4S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | (E)-4-(benzenesulfonyl)-1,1,1-trifluorobut-3-ene-2,2-diol |
| SMILES | O=S(=O)(/C=C/C(O)(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H9F3O4S/c11-10(12,13)9(14,15)6-7-18(16,17)8-4-2-1-3-5-8/h1-7,14-15H/b7-6+ |
| InChIKey | BGEZDULKRPRIDI-VOTSOKGWSA-N |
| XLogP | 1.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|