C15H20Cl2N2O2 — CID 110769554
2-(2,5-dichloro-4-methoxyphenyl)-1-(4-ethylpiperazin-1-yl)ethanone (PubChem CID 110769554) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-methoxyphenyl)-1-(4-ethylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2,5-dichloro-4-methoxyphenyl)-1-(4-ethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110769554 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-(2,5-dichloro-4-methoxyphenyl)-1-(4-ethylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCN(C(=O)Cc2cc(Cl)c(OC)cc2Cl)CC1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-3-18-4-6-19(7-5-18)15(20)9-11-8-13(17)14(21-2)10-12(11)16/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | UZEBZPZNCCXMQJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |