About 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol
5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol (PubChem CID 11076958) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol.
Molecular Properties
| Compound Name | 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol |
| PubChem CID | 11076958 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol |
| SMILES | CC(C)(C)C1(O)c2ccccc2OCOc2ccccc21 |
| InChI | InChI=1S/C18H20O3/c1-17(2,3)18(19)13-8-4-6-10-15(13)20-12-21-16-11-7-5-9-14(16)18/h4-11,19H,12H2,1-3H3 |
| InChIKey | HNDNWNMYRNKSAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol?
The IUPAC name of 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol (CID 11076958) is 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol.
What is the SMILES notation for 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol?
The canonical SMILES for 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol is CC(C)(C)C1(O)c2ccccc2OCOc2ccccc21.
What is the InChIKey of 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol?
The InChIKey is HNDNWNMYRNKSAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-17(2,3)18(19)13-8-4-6-10-15(13)20-12-21-16-11-7-5-9-14(16)18/h4-11,19H,12H2,1-3H3.
What are the key properties of 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol?
5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol has a molecular weight of 284.36 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butylbenzo[d][1,3]benzodioxocin-5-ol is sourced from PubChem (CID 11076958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).