C13H18ClNO2 — CID 110769985
2-(2-chloro-4-methoxyphenyl)-N,N-diethylacetamide (PubChem CID 110769985) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-(2-chloro-4-methoxyphenyl)-N,N-diethylacetamide.
| Compound Name | 2-(2-chloro-4-methoxyphenyl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 110769985 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-(2-chloro-4-methoxyphenyl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cc1ccc(OC)cc1Cl |
| InChI | InChI=1S/C13H18ClNO2/c1-4-15(5-2)13(16)8-10-6-7-11(17-3)9-12(10)14/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | HGPAUZLTJXRNKH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |