C14H26O4Si — CID 11077010
(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol (PubChem CID 11077010) has the molecular formula C14H26O4Si and a molecular weight of 286.44 g/mol. Its IUPAC name is (4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol.
| Compound Name | (4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol |
|---|---|
| PubChem CID | 11077010 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2OC=C[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C14H26O4Si/c1-13(2,3)19(14(4,5)6)17-9-11-12(18-19)10(15)7-8-16-11/h7-8,10-12,15H,9H2,1-6H3/t10-,11-,12+/m1/s1 |
| InChIKey | LZSKFMZUUWAXHF-UTUOFQBUSA-N |
| XLogP | 2.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|