C17H15N3O4 — CID 110770344
4-[[2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetyl]amino]benzamide (PubChem CID 110770344) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-[[2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 110770344 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[[2-(3-oxo-4H-1,4-benzoxazin-6-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)Cc2ccc3c(c2)NC(=O)CO3)cc1 |
| InChI | InChI=1S/C17H15N3O4/c18-17(23)11-2-4-12(5-3-11)19-15(21)8-10-1-6-14-13(7-10)20-16(22)9-24-14/h1-7H,8-9H2,(H2,18,23)(H,19,21)(H,20,22) |
| InChIKey | IDQLQIWWOYEKLN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |