About N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine
N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine (PubChem CID 11077054) has the molecular formula C12H18BrNO2
and a molecular weight of 288.19 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine.
Molecular Properties
| Compound Name | N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine |
| PubChem CID | 11077054 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CNCCc1ccccc1Br)OC |
| InChI | InChI=1S/C12H18BrNO2/c1-15-12(16-2)9-14-8-7-10-5-3-4-6-11(10)13/h3-6,12,14H,7-9H2,1-2H3 |
| InChIKey | BMGWYFDKVJACNJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine?
The IUPAC name of N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine (CID 11077054) is N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine.
What is the SMILES notation for N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine?
The canonical SMILES for N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine is COC(CNCCc1ccccc1Br)OC.
What is the InChIKey of N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine?
The InChIKey is BMGWYFDKVJACNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrNO2/c1-15-12(16-2)9-14-8-7-10-5-3-4-6-11(10)13/h3-6,12,14H,7-9H2,1-2H3.
What are the key properties of N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine?
N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine has a molecular weight of 288.19 g/mol, XLogP of 2.20, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-bromophenyl)ethyl]-2,2-dimethoxyethanamine is sourced from PubChem (CID 11077054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).