C20H22N2O2 — CID 110770933
2-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-N-(1-phenylethyl)acetamide (PubChem CID 110770933) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-N-(1-phenylethyl)acetamide.
| Compound Name | 2-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 110770933 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)Cc1ccc2c(c1)C(C)(C)C(=O)N2)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-13(15-7-5-4-6-8-15)21-18(23)12-14-9-10-17-16(11-14)20(2,3)19(24)22-17/h4-11,13H,12H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | GGTKVHIPSPJTPA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |