About N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide
N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide (PubChem CID 110771058) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide |
| PubChem CID | 110771058 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide |
| SMILES | CN1C(=O)C(C)(C)c2cc(CC(=O)Nc3ccccn3)ccc21 |
| InChI | InChI=1S/C18H19N3O2/c1-18(2)13-10-12(7-8-14(13)21(3)17(18)23)11-16(22)20-15-6-4-5-9-19-15/h4-10H,11H2,1-3H3,(H,19,20,22) |
| InChIKey | UNDVUFJXQUVQBX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide?
The IUPAC name of N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide (CID 110771058) is N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide.
What is the SMILES notation for N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide?
The canonical SMILES for N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide is CN1C(=O)C(C)(C)c2cc(CC(=O)Nc3ccccn3)ccc21.
What is the InChIKey of N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide?
The InChIKey is UNDVUFJXQUVQBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2/c1-18(2)13-10-12(7-8-14(13)21(3)17(18)23)11-16(22)20-15-6-4-5-9-19-15/h4-10H,11H2,1-3H3,(H,19,20,22).
What are the key properties of N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide?
N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide has a molecular weight of 309.37 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-2-yl-2-(1,3,3-trimethyl-2-oxoindol-5-yl)acetamide is sourced from PubChem (CID 110771058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).