About 2-Beta-Acetoxysubergoric Acid
2-Beta-Acetoxysubergoric Acid (PubChem CID 11077190) has the molecular formula C17H24O4
and a molecular weight of 292.40 g/mol. Its IUPAC name is (1R,2S,5R,8R,9S,11S)-11-acetyloxy-2,5,9-trimethyltricyclo[6.3.0.01,5]undec-3-ene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-Beta-Acetoxysubergoric Acid |
| PubChem CID | 11077190 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,2S,5R,8R,9S,11S)-11-acetyloxy-2,5,9-trimethyltricyclo[6.3.0.01,5]undec-3-ene-3-carboxylic acid |
| SMILES | C[C@H]1C[C@@H]([C@@]23[C@@H]1CC[C@@]2(C=C([C@H]3C)C(=O)O)C)OC(=O)C |
| InChI | InChI=1S/C17H24O4/c1-9-7-14(21-11(3)18)17-10(2)12(15(19)20)8-16(17,4)6-5-13(9)17/h8-10,13-14H,5-7H2,1-4H3,(H,19,20)/t9-,10+,13+,14-,16+,17+/m0/s1 |
| InChIKey | MVLDXYFDAJPYLM-PYULSUTASA-N |
| XLogP | 3.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | 537 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-Beta-Acetoxysubergoric Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Beta-Acetoxysubergoric Acid?
The IUPAC name of 2-Beta-Acetoxysubergoric Acid (CID 11077190) is (1R,2S,5R,8R,9S,11S)-11-acetyloxy-2,5,9-trimethyltricyclo[6.3.0.01,5]undec-3-ene-3-carboxylic acid.
What is the SMILES notation for 2-Beta-Acetoxysubergoric Acid?
The canonical SMILES for 2-Beta-Acetoxysubergoric Acid is C[C@H]1C[C@@H]([C@@]23[C@@H]1CC[C@@]2(C=C([C@H]3C)C(=O)O)C)OC(=O)C.
What is the InChIKey of 2-Beta-Acetoxysubergoric Acid?
The InChIKey is MVLDXYFDAJPYLM-PYULSUTASA-N. The full InChI is InChI=1S/C17H24O4/c1-9-7-14(21-11(3)18)17-10(2)12(15(19)20)8-16(17,4)6-5-13(9)17/h8-10,13-14H,5-7H2,1-4H3,(H,19,20)/t9-,10+,13+,14-,16+,17+/m0/s1.
What are the key properties of 2-Beta-Acetoxysubergoric Acid?
2-Beta-Acetoxysubergoric Acid has a molecular weight of 292.40 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Beta-Acetoxysubergoric Acid is sourced from PubChem (CID 11077190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).