C17H24O4 — CID 11077190
(1R,2S,5R,8R,9S,11S)-11-acetyloxy-2,5,9-trimethyltricyclo[6.3.0.01,5]undec-3-ene-3-carboxylic acid (PubChem CID 11077190) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R,2S,5R,8R,9S,11S)-11-acetyloxy-2,5,9-trimethyltricyclo[6.3.0.01,5]undec-3-ene-3-carboxylic acid.
| Compound Name | (1R,2S,5R,8R,9S,11S)-11-acetyloxy-2,5,9-trimethyltricyclo[6.3.0.01,5]undec-3-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 11077190 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,2S,5R,8R,9S,11S)-11-acetyloxy-2,5,9-trimethyltricyclo[6.3.0.01,5]undec-3-ene-3-carboxylic acid |
| SMILES | CC(=O)O[C@H]1C[C@H](C)[C@H]2CC[C@]3(C)C=C(C(=O)O)[C@@H](C)[C@]123 |
| InChI | InChI=1S/C17H24O4/c1-9-7-14(21-11(3)18)17-10(2)12(15(19)20)8-16(17,4)6-5-13(9)17/h8-10,13-14H,5-7H2,1-4H3,(H,19,20)/t9-,10+,13+,14-,16+,17+/m0/s1 |
| InChIKey | MVLDXYFDAJPYLM-PYULSUTASA-N |
| XLogP | 3.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |