C16H12F2N2O2 — CID 110772044
N-(2,4-difluorophenyl)-2-(2-methyl-1,3-benzoxazol-6-yl)acetamide (PubChem CID 110772044) has the molecular formula C16H12F2N2O2 and a molecular weight of 302.28 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(2-methyl-1,3-benzoxazol-6-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(2-methyl-1,3-benzoxazol-6-yl)acetamide |
|---|---|
| PubChem CID | 110772044 |
| Molecular Formula | C16H12F2N2O2 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(2-methyl-1,3-benzoxazol-6-yl)acetamide |
| SMILES | Cc1nc2ccc(CC(=O)Nc3ccc(F)cc3F)cc2o1 |
| InChI | InChI=1S/C16H12F2N2O2/c1-9-19-14-4-2-10(6-15(14)22-9)7-16(21)20-13-5-3-11(17)8-12(13)18/h2-6,8H,7H2,1H3,(H,20,21) |
| InChIKey | QLHLIXXNIJSUCW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |