C19H25NO2 — CID 11077426
1-[(1S)-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 11077426) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-[(1S)-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 1-[(1S)-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 11077426 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-[(1S)-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | COc1ccc(C[C@H]2C3=C(CCCC3)CCN2C(C)=O)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-14(21)20-12-11-16-5-3-4-6-18(16)19(20)13-15-7-9-17(22-2)10-8-15/h7-10,19H,3-6,11-13H2,1-2H3/t19-/m0/s1 |
| InChIKey | YPXQKKBSILHWOE-IBGZPJMESA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|