C14H22O7 — CID 11077497
3-(4-prop-2-enoxybutyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8,9-triol (PubChem CID 11077497) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 3-(4-prop-2-enoxybutyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8,9-triol.
| Compound Name | 3-(4-prop-2-enoxybutyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8,9-triol |
|---|---|
| PubChem CID | 11077497 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-(4-prop-2-enoxybutyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8,9-triol |
| SMILES | C=CCOCCCCC12OC3C(O)C(O1)C(O)C(O2)C3O |
| InChI | InChI=1S/C14H22O7/c1-2-6-18-7-4-3-5-14-19-11-8(15)12(20-14)10(17)13(21-14)9(11)16/h2,8-13,15-17H,1,3-7H2 |
| InChIKey | LHPGHGKCYNPASB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|