C19H26O3 — CID 11077515
(1S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-9-methyltricyclo[7.2.1.01,6]dodeca-2,7-dien-4-one (PubChem CID 11077515) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (1S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-9-methyltricyclo[7.2.1.01,6]dodeca-2,7-dien-4-one.
| Compound Name | (1S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-9-methyltricyclo[7.2.1.01,6]dodeca-2,7-dien-4-one |
|---|---|
| PubChem CID | 11077515 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (1S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-9-methyltricyclo[7.2.1.01,6]dodeca-2,7-dien-4-one |
| SMILES | C[C@]12C=C[C@@H]3CC(=O)C=C(CCCC4OCCO4)[C@@]3(CC1)C2 |
| InChI | InChI=1S/C19H26O3/c1-18-6-5-15-12-16(20)11-14(19(15,13-18)8-7-18)3-2-4-17-21-9-10-22-17/h5-6,11,15,17H,2-4,7-10,12-13H2,1H3/t15-,18+,19-/m1/s1 |
| InChIKey | RZYWAZIWJQAQOK-AYOQOUSVSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|