About (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one
(3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one (PubChem CID 11077576) has the molecular formula C13H20O4S2
and a molecular weight of 304.43 g/mol. Its IUPAC name is (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one.
Molecular Properties
| Compound Name | (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one |
| PubChem CID | 11077576 |
| Molecular Formula | C13H20O4S2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one |
| SMILES | O=C1CCSC[C@@H]1[C@@H](O)[C@@H]1CSCCC12OCCO2 |
| InChI | InChI=1S/C13H20O4S2/c14-11-1-5-18-7-9(11)12(15)10-8-19-6-2-13(10)16-3-4-17-13/h9-10,12,15H,1-8H2/t9-,10-,12+/m0/s1 |
| InChIKey | BCKIAWGIFHKTDK-JBLDHEPKSA-N |
| XLogP | 1.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one?
The IUPAC name of (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one (CID 11077576) is (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one.
What is the SMILES notation for (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one?
The canonical SMILES for (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one is O=C1CCSC[C@@H]1[C@@H](O)[C@@H]1CSCCC12OCCO2.
What is the InChIKey of (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one?
The InChIKey is BCKIAWGIFHKTDK-JBLDHEPKSA-N. The full InChI is InChI=1S/C13H20O4S2/c14-11-1-5-18-7-9(11)12(15)10-8-19-6-2-13(10)16-3-4-17-13/h9-10,12,15H,1-8H2/t9-,10-,12+/m0/s1.
What are the key properties of (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one?
(3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one has a molecular weight of 304.43 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-hydroxymethyl]thian-4-one is sourced from PubChem (CID 11077576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).