About 4-butoxy-2,6-dipyridin-2-ylpyridine
4-butoxy-2,6-dipyridin-2-ylpyridine (PubChem CID 11077609) has the molecular formula C19H19N3O
and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-butoxy-2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-butoxy-2,6-dipyridin-2-ylpyridine |
| PubChem CID | 11077609 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-butoxy-2,6-dipyridin-2-ylpyridine |
| SMILES | CCCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C19H19N3O/c1-2-3-12-23-15-13-18(16-8-4-6-10-20-16)22-19(14-15)17-9-5-7-11-21-17/h4-11,13-14H,2-3,12H2,1H3 |
| InChIKey | XOFIVGPUXALVCN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-2,6-dipyridin-2-ylpyridine?
The IUPAC name of 4-butoxy-2,6-dipyridin-2-ylpyridine (CID 11077609) is 4-butoxy-2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for 4-butoxy-2,6-dipyridin-2-ylpyridine?
The canonical SMILES for 4-butoxy-2,6-dipyridin-2-ylpyridine is CCCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1.
What is the InChIKey of 4-butoxy-2,6-dipyridin-2-ylpyridine?
The InChIKey is XOFIVGPUXALVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O/c1-2-3-12-23-15-13-18(16-8-4-6-10-20-16)22-19(14-15)17-9-5-7-11-21-17/h4-11,13-14H,2-3,12H2,1H3.
What are the key properties of 4-butoxy-2,6-dipyridin-2-ylpyridine?
4-butoxy-2,6-dipyridin-2-ylpyridine has a molecular weight of 305.38 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 11077609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).