C16H16FNO4 — CID 110776470
N-(3-fluoro-4-methoxyphenyl)-2,6-dimethoxybenzamide (PubChem CID 110776470) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-2,6-dimethoxybenzamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 110776470 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-2,6-dimethoxybenzamide |
| SMILES | COc1ccc(NC(=O)c2c(OC)cccc2OC)cc1F |
| InChI | InChI=1S/C16H16FNO4/c1-20-12-8-7-10(9-11(12)17)18-16(19)15-13(21-2)5-4-6-14(15)22-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | XUZSSUDIZJKHDP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |