C14H20FNO2 — CID 110777393
N-(4-ethoxy-3-fluorophenyl)-3,3-dimethylbutanamide (PubChem CID 110777393) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is N-(4-ethoxy-3-fluorophenyl)-3,3-dimethylbutanamide.
| Compound Name | N-(4-ethoxy-3-fluorophenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 110777393 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-(4-ethoxy-3-fluorophenyl)-3,3-dimethylbutanamide |
| SMILES | CCOc1ccc(NC(=O)CC(C)(C)C)cc1F |
| InChI | InChI=1S/C14H20FNO2/c1-5-18-12-7-6-10(8-11(12)15)16-13(17)9-14(2,3)4/h6-8H,5,9H2,1-4H3,(H,16,17) |
| InChIKey | HCJCDSXQERRKIY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |