C14H14ClNO2S2 — CID 110778592
1-(4-chlorophenyl)-N-(4-methylsulfanylphenyl)methanesulfonamide (PubChem CID 110778592) has the molecular formula C14H14ClNO2S2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(4-methylsulfanylphenyl)methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-(4-methylsulfanylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110778592 |
| Molecular Formula | C14H14ClNO2S2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(4-methylsulfanylphenyl)methanesulfonamide |
| SMILES | CSc1ccc(NS(=O)(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H14ClNO2S2/c1-19-14-8-6-13(7-9-14)16-20(17,18)10-11-2-4-12(15)5-3-11/h2-9,16H,10H2,1H3 |
| InChIKey | NYCBTQLWQMMRIA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |