C18H34O3Si — CID 11077911
(E,4R,7R,8S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methylundec-5-en-10-yne-1,8-diol (PubChem CID 11077911) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (E,4R,7R,8S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methylundec-5-en-10-yne-1,8-diol.
| Compound Name | (E,4R,7R,8S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methylundec-5-en-10-yne-1,8-diol |
|---|---|
| PubChem CID | 11077911 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (E,4R,7R,8S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methylundec-5-en-10-yne-1,8-diol |
| SMILES | C#CC[C@H](O)[C@H](C)/C=C/[C@@H](CCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-8-10-17(20)15(2)12-13-16(11-9-14-19)21-22(6,7)18(3,4)5/h1,12-13,15-17,19-20H,9-11,14H2,2-7H3/b13-12+/t15-,16-,17+/m1/s1 |
| InChIKey | DXTZMQNUYGAYAZ-JLMGGWNCSA-N |
| XLogP | 3.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|