About tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane
tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane (PubChem CID 11077915) has the molecular formula C20H42OSi
and a molecular weight of 326.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane |
| PubChem CID | 11077915 |
| Molecular Formula | C20H42OSi |
| Molecular Weight | 326.64 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane |
| SMILES | CCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=C(C)C)CCCC |
| InChI | InChI=1S/C20H42OSi/c1-10-12-14-18(16-17(3)4)19(15-13-11-2)21-22(8,9)20(5,6)7/h16,18-19H,10-15H2,1-9H3/t18-,19+/m1/s1 |
| InChIKey | PTXDAEIMVBQKKG-MOPGFXCFSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane?
The IUPAC name of tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane (CID 11077915) is tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane.
What is the SMILES notation for tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane?
The canonical SMILES for tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane is CCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=C(C)C)CCCC.
What is the InChIKey of tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane?
The InChIKey is PTXDAEIMVBQKKG-MOPGFXCFSA-N. The full InChI is InChI=1S/C20H42OSi/c1-10-12-14-18(16-17(3)4)19(15-13-11-2)21-22(8,9)20(5,6)7/h16,18-19H,10-15H2,1-9H3/t18-,19+/m1/s1.
What are the key properties of tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane?
tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane has a molecular weight of 326.64 g/mol, XLogP of 7.34, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(5S,6R)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane is sourced from PubChem (CID 11077915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).