C20H26O4 — CID 11078036
(2S,6aS,10aS,10bR)-7,7,10a-trimethyl-2-(5-oxo-2H-furan-3-yl)-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one (PubChem CID 11078036) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (2S,6aS,10aS,10bR)-7,7,10a-trimethyl-2-(5-oxo-2H-furan-3-yl)-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one.
| Compound Name | (2S,6aS,10aS,10bR)-7,7,10a-trimethyl-2-(5-oxo-2H-furan-3-yl)-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one |
|---|---|
| PubChem CID | 11078036 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2S,6aS,10aS,10bR)-7,7,10a-trimethyl-2-(5-oxo-2H-furan-3-yl)-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3C[C@@H](C4=CC(=O)OC4)OC(=O)C3=CC[C@@H]12 |
| InChI | InChI=1S/C20H26O4/c1-19(2)7-4-8-20(3)14-10-15(12-9-17(21)23-11-12)24-18(22)13(14)5-6-16(19)20/h5,9,14-16H,4,6-8,10-11H2,1-3H3/t14-,15-,16-,20+/m0/s1 |
| InChIKey | GOBSCLZIJMEAOF-ZKNHNOBHSA-N |
| XLogP | 3.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |