C13H15F2NO — CID 110781018
N-[(3,4-difluorophenyl)methyl]cyclopentanecarboxamide (PubChem CID 110781018) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]cyclopentanecarboxamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110781018 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]cyclopentanecarboxamide |
| SMILES | O=C(NCc1ccc(F)c(F)c1)C1CCCC1 |
| InChI | InChI=1S/C13H15F2NO/c14-11-6-5-9(7-12(11)15)8-16-13(17)10-3-1-2-4-10/h5-7,10H,1-4,8H2,(H,16,17) |
| InChIKey | VUEQRADDBSPKLB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |