About oxolane;tetrabutylazanium;fluoride
oxolane;tetrabutylazanium;fluoride (PubChem CID 11078149) has the molecular formula C20H44FNO
and a molecular weight of 333.58 g/mol. Its IUPAC name is oxolane;tetrabutylazanium;fluoride.
Molecular Properties
| Compound Name | oxolane;tetrabutylazanium;fluoride |
| PubChem CID | 11078149 |
| Molecular Formula | C20H44FNO |
| Molecular Weight | 333.58 g/mol |
| Exact Mass | 333.34 |
| IUPAC Name | oxolane;tetrabutylazanium;fluoride |
| SMILES | C1CCOC1.CCCC[N+](CCCC)(CCCC)CCCC.[F-] |
| InChI | InChI=1S/C16H36N.C4H8O.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-4-5-3-1;/h5-16H2,1-4H3;1-4H2;1H/q+1;;/p-1 |
| InChIKey | YWWARDMVSMPOLR-UHFFFAOYSA-M |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxolane;tetrabutylazanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;tetrabutylazanium;fluoride?
The IUPAC name of oxolane;tetrabutylazanium;fluoride (CID 11078149) is oxolane;tetrabutylazanium;fluoride.
What is the SMILES notation for oxolane;tetrabutylazanium;fluoride?
The canonical SMILES for oxolane;tetrabutylazanium;fluoride is C1CCOC1.CCCC[N+](CCCC)(CCCC)CCCC.[F-].
What is the InChIKey of oxolane;tetrabutylazanium;fluoride?
The InChIKey is YWWARDMVSMPOLR-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C4H8O.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-4-5-3-1;/h5-16H2,1-4H3;1-4H2;1H/q+1;;/p-1.
What are the key properties of oxolane;tetrabutylazanium;fluoride?
oxolane;tetrabutylazanium;fluoride has a molecular weight of 333.58 g/mol, XLogP of 2.80, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;tetrabutylazanium;fluoride is sourced from PubChem (CID 11078149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).