C18H20ClNO4 — CID 110782051
N-[(3-chloro-4-ethoxyphenyl)methyl]-3,5-dimethoxybenzamide (PubChem CID 110782051) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxyphenyl)methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(3-chloro-4-ethoxyphenyl)methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 110782051 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[(3-chloro-4-ethoxyphenyl)methyl]-3,5-dimethoxybenzamide |
| SMILES | CCOc1ccc(CNC(=O)c2cc(OC)cc(OC)c2)cc1Cl |
| InChI | InChI=1S/C18H20ClNO4/c1-4-24-17-6-5-12(7-16(17)19)11-20-18(21)13-8-14(22-2)10-15(9-13)23-3/h5-10H,4,11H2,1-3H3,(H,20,21) |
| InChIKey | UUCILTFDUVROES-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |