C15H22FNO2 — CID 110782111
N-[(3-fluoro-4-propan-2-yloxyphenyl)methyl]-3-methylbutanamide (PubChem CID 110782111) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[(3-fluoro-4-propan-2-yloxyphenyl)methyl]-3-methylbutanamide.
| Compound Name | N-[(3-fluoro-4-propan-2-yloxyphenyl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 110782111 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[(3-fluoro-4-propan-2-yloxyphenyl)methyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NCc1ccc(OC(C)C)c(F)c1 |
| InChI | InChI=1S/C15H22FNO2/c1-10(2)7-15(18)17-9-12-5-6-14(13(16)8-12)19-11(3)4/h5-6,8,10-11H,7,9H2,1-4H3,(H,17,18) |
| InChIKey | FYXJXQBNYACZIF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |