C11H18N2O — CID 110782459
N-[(1-methylpyrrol-3-yl)methyl]pentanamide (PubChem CID 110782459) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[(1-methylpyrrol-3-yl)methyl]pentanamide.
| Compound Name | N-[(1-methylpyrrol-3-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 110782459 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-[(1-methylpyrrol-3-yl)methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1ccn(C)c1 |
| InChI | InChI=1S/C11H18N2O/c1-3-4-5-11(14)12-8-10-6-7-13(2)9-10/h6-7,9H,3-5,8H2,1-2H3,(H,12,14) |
| InChIKey | CTPHHCKSVBDDMJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |