About 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol
2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol (PubChem CID 11078278) has the molecular formula C19H30O3S
and a molecular weight of 338.51 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol.
Molecular Properties
| Compound Name | 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol |
| PubChem CID | 11078278 |
| Molecular Formula | C19H30O3S |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol |
| SMILES | C=C(C(O)CC(C)CCCC(C)(C)OC)S(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O3S/c1-15(10-9-13-19(3,4)22-5)14-18(20)16(2)23(21)17-11-7-6-8-12-17/h6-8,11-12,15,18,20H,2,9-10,13-14H2,1,3-5H3 |
| InChIKey | OPPMRVOVELFYAC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol?
The IUPAC name of 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol (CID 11078278) is 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol.
What is the SMILES notation for 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol?
The canonical SMILES for 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol is C=C(C(O)CC(C)CCCC(C)(C)OC)S(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol?
The InChIKey is OPPMRVOVELFYAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O3S/c1-15(10-9-13-19(3,4)22-5)14-18(20)16(2)23(21)17-11-7-6-8-12-17/h6-8,11-12,15,18,20H,2,9-10,13-14H2,1,3-5H3.
What are the key properties of 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol?
2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol has a molecular weight of 338.51 g/mol, XLogP of 4.29, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfinyl)-9-methoxy-5,9-dimethyldec-1-en-3-ol is sourced from PubChem (CID 11078278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).