C18H23Cl2NO — CID 11078321
3-(2-chlorophenyl)propyl-[(1R)-1-(3-methoxyphenyl)ethyl]azanium chloride (PubChem CID 11078321) has the molecular formula C18H23Cl2NO and a molecular weight of 340.29 g/mol. Its IUPAC name is 3-(2-chlorophenyl)propyl-[(1R)-1-(3-methoxyphenyl)ethyl]azanium chloride.
| Compound Name | 3-(2-chlorophenyl)propyl-[(1R)-1-(3-methoxyphenyl)ethyl]azanium chloride |
|---|---|
| PubChem CID | 11078321 |
| Molecular Formula | C18H23Cl2NO |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 3-(2-chlorophenyl)propyl-[(1R)-1-(3-methoxyphenyl)ethyl]azanium chloride |
| SMILES | COc1cccc([C@@H](C)[NH2+]CCCc2ccccc2Cl)c1.[Cl-] |
| InChI | InChI=1S/C18H22ClNO.ClH/c1-14(16-8-5-10-17(13-16)21-2)20-12-6-9-15-7-3-4-11-18(15)19;/h3-5,7-8,10-11,13-14,20H,6,9,12H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | YJXUXANREVNZLH-PFEQFJNWSA-N |
| XLogP | 0.61 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|