C13H16N2O3 — CID 110783694
N-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)methyl]acetamide (PubChem CID 110783694) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)methyl]acetamide.
| Compound Name | N-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)methyl]acetamide |
|---|---|
| PubChem CID | 110783694 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)methyl]acetamide |
| SMILES | CC(=O)NCc1ccc2c(c1)N(C)C(=O)C(C)O2 |
| InChI | InChI=1S/C13H16N2O3/c1-8-13(17)15(3)11-6-10(7-14-9(2)16)4-5-12(11)18-8/h4-6,8H,7H2,1-3H3,(H,14,16) |
| InChIKey | WYDLKWSUHXCPSL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |