C14H20N4O2S — CID 110786179
2-cyclopropyl-5-[(dimethylsulfamoylamino)methyl]-1-methylbenzimidazole (PubChem CID 110786179) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-cyclopropyl-5-[(dimethylsulfamoylamino)methyl]-1-methylbenzimidazole.
| Compound Name | 2-cyclopropyl-5-[(dimethylsulfamoylamino)methyl]-1-methylbenzimidazole |
|---|---|
| PubChem CID | 110786179 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-cyclopropyl-5-[(dimethylsulfamoylamino)methyl]-1-methylbenzimidazole |
| SMILES | CN(C)S(=O)(=O)NCc1ccc2c(c1)nc(C1CC1)n2C |
| InChI | InChI=1S/C14H20N4O2S/c1-17(2)21(19,20)15-9-10-4-7-13-12(8-10)16-14(18(13)3)11-5-6-11/h4,7-8,11,15H,5-6,9H2,1-3H3 |
| InChIKey | LYHQIFJZHYNIRG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |