About (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine
(2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine (PubChem CID 11078657) has the molecular formula C22H29N3O
and a molecular weight of 351.49 g/mol. Its IUPAC name is (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine.
Molecular Properties
| Compound Name | (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine |
| PubChem CID | 11078657 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine |
| SMILES | COC[C@@H]1CCCN1/N=C/CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H29N3O/c1-26-19-22-13-8-15-25(22)23-14-16-24(17-20-9-4-2-5-10-20)18-21-11-6-3-7-12-21/h2-7,9-12,14,22H,8,13,15-19H2,1H3/b23-14+/t22-/m0/s1 |
| InChIKey | MDZLOTHGLNFJDE-DHNIJCFSSA-N |
| XLogP | 3.79 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine?
The IUPAC name of (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine (CID 11078657) is (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine.
What is the SMILES notation for (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine?
The canonical SMILES for (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine is COC[C@@H]1CCCN1/N=C/CN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine?
The InChIKey is MDZLOTHGLNFJDE-DHNIJCFSSA-N. The full InChI is InChI=1S/C22H29N3O/c1-26-19-22-13-8-15-25(22)23-14-16-24(17-20-9-4-2-5-10-20)18-21-11-6-3-7-12-21/h2-7,9-12,14,22H,8,13,15-19H2,1H3/b23-14+/t22-/m0/s1.
What are the key properties of (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine?
(2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine has a molecular weight of 351.49 g/mol, XLogP of 3.79, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N,N-dibenzyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminoethanamine is sourced from PubChem (CID 11078657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).