C18H24O7 — CID 11078677
(1S,2S,6S,7R)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione (PubChem CID 11078677) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is (1S,2S,6S,7R)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione.
| Compound Name | (1S,2S,6S,7R)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
|---|---|
| PubChem CID | 11078677 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (1S,2S,6S,7R)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C(C3OCC(C)(C)CO3)[C@H]1[C@H]1OC(=O)C[C@H]12 |
| InChI | InChI=1S/C18H24O7/c1-17(2)7-23-16(24-8-17)11-5-10-9-6-12(19)25-14(9)13(11)18(21-3,22-4)15(10)20/h5,9-10,13-14,16H,6-8H2,1-4H3/t9-,10+,13-,14-/m0/s1 |
| InChIKey | UDPKROGQUDNJIS-DJBIQUGXSA-N |
| XLogP | 1.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|