C14H11ClN2O4S — CID 110786829
3-chloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzenesulfonamide (PubChem CID 110786829) has the molecular formula C14H11ClN2O4S and a molecular weight of 338.77 g/mol. Its IUPAC name is 3-chloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110786829 |
| Molecular Formula | C14H11ClN2O4S |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 3-chloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzenesulfonamide |
| SMILES | O=c1[nH]c2cc(CNS(=O)(=O)c3cccc(Cl)c3)ccc2o1 |
| InChI | InChI=1S/C14H11ClN2O4S/c15-10-2-1-3-11(7-10)22(19,20)16-8-9-4-5-13-12(6-9)17-14(18)21-13/h1-7,16H,8H2,(H,17,18) |
| InChIKey | XYZCGPGUDDHSEG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |