C16H13F2NO2 — CID 110787075
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3,4-difluorobenzamide (PubChem CID 110787075) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3,4-difluorobenzamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 110787075 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3,4-difluorobenzamide |
| SMILES | O=C(NCc1ccc2c(c1)CCO2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F2NO2/c17-13-3-2-12(8-14(13)18)16(20)19-9-10-1-4-15-11(7-10)5-6-21-15/h1-4,7-8H,5-6,9H2,(H,19,20) |
| InChIKey | PUBLOGCKNDSVLP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |