C12H17NO2 — CID 110787753
methyl N-[2-(2,4-dimethylphenyl)ethyl]carbamate (PubChem CID 110787753) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is methyl N-[2-(2,4-dimethylphenyl)ethyl]carbamate.
| Compound Name | methyl N-[2-(2,4-dimethylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 110787753 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | methyl N-[2-(2,4-dimethylphenyl)ethyl]carbamate |
| SMILES | COC(=O)NCCc1ccc(C)cc1C |
| InChI | InChI=1S/C12H17NO2/c1-9-4-5-11(10(2)8-9)6-7-13-12(14)15-3/h4-5,8H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | GWSWVTGINLLMJD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |