C21H28N2O3 — CID 11078804
6-[(3,5-dimethylphenyl)methyl]-1-(2-methylprop-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 11078804) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 6-[(3,5-dimethylphenyl)methyl]-1-(2-methylprop-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-[(3,5-dimethylphenyl)methyl]-1-(2-methylprop-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11078804 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 6-[(3,5-dimethylphenyl)methyl]-1-(2-methylprop-2-enoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | C=C(C)COCn1c(Cc2cc(C)cc(C)c2)c(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H28N2O3/c1-13(2)11-26-12-23-18(10-17-8-15(5)7-16(6)9-17)19(14(3)4)20(24)22-21(23)25/h7-9,14H,1,10-12H2,2-6H3,(H,22,24,25) |
| InChIKey | RCEIRBUGBJBKRC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|