C23H32OS — CID 11078809
[(1R,2R,5S,6S,8R,9R)-5,8-dimethyl-2-phenylsulfanyl-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undec-3-enyl]methanol (PubChem CID 11078809) has the molecular formula C23H32OS and a molecular weight of 356.58 g/mol. Its IUPAC name is [(1R,2R,5S,6S,8R,9R)-5,8-dimethyl-2-phenylsulfanyl-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undec-3-enyl]methanol.
| Compound Name | [(1R,2R,5S,6S,8R,9R)-5,8-dimethyl-2-phenylsulfanyl-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undec-3-enyl]methanol |
|---|---|
| PubChem CID | 11078809 |
| Molecular Formula | C23H32OS |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [(1R,2R,5S,6S,8R,9R)-5,8-dimethyl-2-phenylsulfanyl-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undec-3-enyl]methanol |
| SMILES | CC(C)[C@H]1CC[C@]23[C@H](Sc4ccccc4)C=C[C@@]2(C)[C@@H](CO)C[C@]13C |
| InChI | InChI=1S/C23H32OS/c1-16(2)19-10-13-23-20(25-18-8-6-5-7-9-18)11-12-21(23,3)17(15-24)14-22(19,23)4/h5-9,11-12,16-17,19-20,24H,10,13-15H2,1-4H3/t17-,19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | WWXNZPFCYUFKES-VUOLKEHKSA-N |
| XLogP | 5.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|