C14H13F2NOS — CID 110788173
N-[2-(2,5-difluorophenyl)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 110788173) has the molecular formula C14H13F2NOS and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenyl)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(2,5-difluorophenyl)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 110788173 |
| Molecular Formula | C14H13F2NOS |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[2-(2,5-difluorophenyl)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H13F2NOS/c15-11-3-4-13(16)10(8-11)5-6-17-14(18)9-12-2-1-7-19-12/h1-4,7-8H,5-6,9H2,(H,17,18) |
| InChIKey | UGWAMMSRWDHZLL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |