C16H14F3NO2 — CID 110788270
N-[2-(3,4-difluorophenyl)ethyl]-2-(2-fluorophenoxy)acetamide (PubChem CID 110788270) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)ethyl]-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-[2-(3,4-difluorophenyl)ethyl]-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 110788270 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)ethyl]-2-(2-fluorophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1F)NCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H14F3NO2/c17-12-6-5-11(9-14(12)19)7-8-20-16(21)10-22-15-4-2-1-3-13(15)18/h1-6,9H,7-8,10H2,(H,20,21) |
| InChIKey | PHOMFONIFWNYLZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |