C19H38O4Si — CID 11078856
tert-butyl-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienoxy]-dimethylsilane (PubChem CID 11078856) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is tert-butyl-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11078856 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | tert-butyl-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienoxy]-dimethylsilane |
| SMILES | COCCOCOC/C=C/C=C/C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-18(2,3)24(7,8)23-16-19(4,5)12-10-9-11-13-21-17-22-15-14-20-6/h9-12H,13-17H2,1-8H3/b11-9+,12-10+ |
| InChIKey | SJDGGMRGKUBOFF-WGDLNXRISA-N |
| XLogP | 4.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|