C17H20N2O2 — CID 110788777
N-[2-(5-ethyl-2-methoxyphenyl)ethyl]pyridine-4-carboxamide (PubChem CID 110788777) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[2-(5-ethyl-2-methoxyphenyl)ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-(5-ethyl-2-methoxyphenyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 110788777 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[2-(5-ethyl-2-methoxyphenyl)ethyl]pyridine-4-carboxamide |
| SMILES | CCc1ccc(OC)c(CCNC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-3-13-4-5-16(21-2)15(12-13)8-11-19-17(20)14-6-9-18-10-7-14/h4-7,9-10,12H,3,8,11H2,1-2H3,(H,19,20) |
| InChIKey | SUPZXASGUSJVRF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |