C20H21FN2O2 — CID 110789127
N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-(4-fluorophenoxy)acetamide (PubChem CID 110789127) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-(4-fluorophenoxy)acetamide.
| Compound Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-(4-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 110789127 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-(4-fluorophenoxy)acetamide |
| SMILES | Cc1c(CCNC(=O)COc2ccc(F)cc2)c2ccccc2n1C |
| InChI | InChI=1S/C20H21FN2O2/c1-14-17(18-5-3-4-6-19(18)23(14)2)11-12-22-20(24)13-25-16-9-7-15(21)8-10-16/h3-10H,11-13H2,1-2H3,(H,22,24) |
| InChIKey | KYTIDVDPNFWCAJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|