C22H38O2Si — CID 11078977
tri(propan-2-yl)silyl (2E,4E,6E)-7-cyclohexylhepta-2,4,6-trienoate (PubChem CID 11078977) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is tri(propan-2-yl)silyl (2E,4E,6E)-7-cyclohexylhepta-2,4,6-trienoate.
| Compound Name | tri(propan-2-yl)silyl (2E,4E,6E)-7-cyclohexylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 11078977 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | tri(propan-2-yl)silyl (2E,4E,6E)-7-cyclohexylhepta-2,4,6-trienoate |
| SMILES | CC(C)[Si](OC(=O)/C=C/C=C/C=C/C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-18(2)25(19(3)4,20(5)6)24-22(23)17-13-8-7-10-14-21-15-11-9-12-16-21/h7-8,10,13-14,17-21H,9,11-12,15-16H2,1-6H3/b8-7+,14-10+,17-13+ |
| InChIKey | ABFYIYSUTZSVII-DCUCIPCRSA-N |
| XLogP | 6.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|