C21H22FN5 — CID 11078996
2-N-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-(2-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 11078996) has the molecular formula C21H22FN5 and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-N-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-(2-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-(2-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11078996 |
| Molecular Formula | C21H22FN5 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-N-(5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-6-(2-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)c2c(c1)C(Nc1nc(N)nc(-c3ccccc3F)n1)CCC2 |
| InChI | InChI=1S/C21H22FN5/c1-12-10-13(2)14-7-5-9-18(16(14)11-12)24-21-26-19(25-20(23)27-21)15-6-3-4-8-17(15)22/h3-4,6,8,10-11,18H,5,7,9H2,1-2H3,(H3,23,24,25,26,27) |
| InChIKey | KTCWMZIEIYOIFZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |