C19H32O5Si — CID 11079125
dimethyl 3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate (PubChem CID 11079125) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is dimethyl 3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11079125 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | dimethyl 3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(O[Si](C)(C)C(C)(C)C)=C2CCCCC21 |
| InChI | InChI=1S/C19H32O5Si/c1-18(2,3)25(6,7)24-15-12-19(16(20)22-4,17(21)23-5)14-11-9-8-10-13(14)15/h14H,8-12H2,1-7H3 |
| InChIKey | QKZGWLMVPBHUSC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|