C22H24S2Si — CID 11079444
2,2-bis(phenylsulfanyl)ethyl-dimethyl-phenylsilane (PubChem CID 11079444) has the molecular formula C22H24S2Si and a molecular weight of 380.65 g/mol. Its IUPAC name is 2,2-bis(phenylsulfanyl)ethyl-dimethyl-phenylsilane.
| Compound Name | 2,2-bis(phenylsulfanyl)ethyl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11079444 |
| Molecular Formula | C22H24S2Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2,2-bis(phenylsulfanyl)ethyl-dimethyl-phenylsilane |
| SMILES | C[Si](C)(CC(Sc1ccccc1)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24S2Si/c1-25(2,21-16-10-5-11-17-21)18-22(23-19-12-6-3-7-13-19)24-20-14-8-4-9-15-20/h3-17,22H,18H2,1-2H3 |
| InChIKey | UHMFEWCNYVOXSH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|