About tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate
tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate (PubChem CID 11079467) has the molecular formula C20H35NO4Si
and a molecular weight of 381.59 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate |
| PubChem CID | 11079467 |
| Molecular Formula | C20H35NO4Si |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H35NO4Si/c1-19(2,3)25-18(23)21-16(14-24-26(7,8)20(4,5)6)17(22)15-12-10-9-11-13-15/h9-13,16-17,22H,14H2,1-8H3,(H,21,23)/t16-,17-/m1/s1 |
| InChIKey | UKNSRCWZMSUVCE-IAGOWNOFSA-N |
| XLogP | 4.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate (CID 11079467) is tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate is CC(C)(C)OC(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)c1ccccc1.
What is the InChIKey of tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate?
The InChIKey is UKNSRCWZMSUVCE-IAGOWNOFSA-N. The full InChI is InChI=1S/C20H35NO4Si/c1-19(2,3)25-18(23)21-16(14-24-26(7,8)20(4,5)6)17(22)15-12-10-9-11-13-15/h9-13,16-17,22H,14H2,1-8H3,(H,21,23)/t16-,17-/m1/s1.
What are the key properties of tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate?
tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate has a molecular weight of 381.59 g/mol, XLogP of 4.64, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-phenylpropan-2-yl]carbamate is sourced from PubChem (CID 11079467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).