C13H16N4O — CID 110794826
N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyrazine-2-carboxamide (PubChem CID 110794826) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110794826 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N-[(1,2,5-trimethylpyrrol-3-yl)methyl]pyrazine-2-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2cnccn2)c(C)n1C |
| InChI | InChI=1S/C13H16N4O/c1-9-6-11(10(2)17(9)3)7-16-13(18)12-8-14-4-5-15-12/h4-6,8H,7H2,1-3H3,(H,16,18) |
| InChIKey | NZNABQXYQQNFBK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |